CAS 66234-68-2 is the registry number for 2-([1,2,4]Triazolo[4,3-a]pyridin-3-ylthio)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetamide (CAS 66234-68-2) is a chemical compound with the molecular formula C8H8N4OS and a molecular weight of 208.24 g/mol. IUPAC name: 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetamide. InChIKey: KKSAOPGDAQOLBM-UHFFFAOYSA-N.
| Molecular formula | C8H8N4OS |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetamide |
| InChIKey | KKSAOPGDAQOLBM-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=C(N2C=C1)SCC(=O)N |
Computed by PubChem (NCBI)