CAS 92352-25-5 appears in our catalog under these names: 3-(Thiophen-2-yl)-1h-pyrazole-5-carbohydrazide, 95%, 5-(2-Thienyl)-1h-pyrazole-3-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5-thiophen-2-yl-1H-pyrazole-3-carbohydrazide (CAS 92352-25-5) is a chemical compound with the molecular formula C8H8N4OS and a molecular weight of 208.24 g/mol. IUPAC name: 5-thiophen-2-yl-1H-pyrazole-3-carbohydrazide. InChIKey: JHJCTDRHIVSVRT-UHFFFAOYSA-N.
| Molecular formula | C8H8N4OS |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 5-thiophen-2-yl-1H-pyrazole-3-carbohydrazide |
| InChIKey | JHJCTDRHIVSVRT-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=NN2)C(=O)NN |
Computed by PubChem (NCBI)