CAS 54057-95-3 appears in our catalog under these names: 4-Aminocinnamic acid hydrochloride, 95%, 4-Aminocinnamic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 2g.
3-(4-aminophenyl)prop-2-enoic acid;hydrochloride (CAS 54057-95-3) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 3-(4-aminophenyl)prop-2-enoic acid;hydrochloride. InChIKey: SFRAURMUQMJLPG-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 3-(4-aminophenyl)prop-2-enoic acid;hydrochloride |
| InChIKey | SFRAURMUQMJLPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=CC(=O)O)N.Cl |
Computed by PubChem (NCBI)