CAS 54108-62-2 is the registry number for Ipratropium Bromide Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-oxo-2,3-diphenylpropanoate (CAS 54108-62-2) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: methyl 3-oxo-2,3-diphenylpropanoate. InChIKey: UNDMMNILNUQQOV-UHFFFAOYSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | methyl 3-oxo-2,3-diphenylpropanoate |
| InChIKey | UNDMMNILNUQQOV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=CC=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)