Products 5413-05-8
CAS 5413-05-8 appears in our catalog under these names: Ethyl 2-phenylacetoacetate, 95%, Ethyl 2–phenylacetoacetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 25g, 100g, 10g, 5g, 5mg.
Ethyl 3-oxo-2-phenylbutanoate (CAS 5413-05-8) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: ethyl 3-oxo-2-phenylbutanoate. InChIKey: PWRUKIPYVGHRFL-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | ethyl 3-oxo-2-phenylbutanoate |
| InChIKey | PWRUKIPYVGHRFL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC=C1)C(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Ethyl acetylphenylacetate, Benzeneacetic acid, alpha-acetyl-, ethyl ester, Benzeneacetic acid, .alpha.-acetyl-, ethyl ester, Ethyl 2-phenylacetoacetate, ethyl 3-oxo-2-phenylbutanoate, Ethyl a-acetylbenzeneacetate, 3-oxo-2-phenyl-butyric acid ethyl ester, 2-phenylacetoacetic acid ethyl ester, ethyl 3-oxo-2-phenyl-butanoate, alpha-phenylacetoacetic acid ethyl ester