CAS 54136-23-1 appears in our catalog under these names: 5-Fluoro-2,3,3-trimethyl-3H-indole, 98%, 98%, 5-fluoro-2,3,3-triMethyl-3H-Indole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
5-fluoro-2,3,3-trimethylindole (CAS 54136-23-1) is a chemical compound with the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. IUPAC name: 5-fluoro-2,3,3-trimethylindole. InChIKey: CNIGIKJWPKTMGG-UHFFFAOYSA-N.
| Molecular formula | C11H12FN |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 5-fluoro-2,3,3-trimethylindole |
| InChIKey | CNIGIKJWPKTMGG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)C)C=C(C=C2)F |
Computed by PubChem (NCBI)