Products 54142-77-7
CAS 54142-77-7 appears in our catalog under these names: 2–Keto–D–galactose, 2-Keto-D-galactose. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
(3S,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexanal (CAS 54142-77-7) is a chemical compound with the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. IUPAC name: (3S,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexanal. InChIKey: DCNMIDLYWOTSGK-PBXRRBTRSA-N.
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | (3S,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexanal |
| InChIKey | DCNMIDLYWOTSGK-PBXRRBTRSA-N |
| SMILES | C([C@H]([C@@H]([C@@H](C(=O)C=O)O)O)O)O |
Computed by PubChem (NCBI)