Products 54231-32-2
CAS 54231-32-2 appears in our catalog under these names: 3–Chloro–2–nitropyridine, 3-Chloro-2-nitropyridine, 3-Chloro-2-nitropyridine 98%, 3-Chloro-2-nitropyridine, 97%, 3-Chloro-2-nitropyridine, >98.0%(GC). Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, TCI. Available pack sizes: 1g, 250mg, 25g, 5g, 2g, 10g, 100mg.
3-chloro-2-nitropyridine (CAS 54231-32-2) is a chemical compound with the molecular formula C5H3ClN2O2 and a molecular weight of 158.54 g/mol. IUPAC name: 3-chloro-2-nitropyridine. InChIKey: PSGASDJUCYTRAD-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O2 |
|---|---|
| Molecular weight | 158.54 g/mol |
| IUPAC name | 3-chloro-2-nitropyridine |
| InChIKey | PSGASDJUCYTRAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)