CAS 5424-16-8 appears in our catalog under these names: endo-8-methyl-8-azabicyclo[3.2.1]octan-3-amine,dihydrochloride, 97%, 97%, 3-Alpha-aminotropanedihydrochloride, 97%. Offered by: Chemat, AmBeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine;dihydrochloride (CAS 5424-16-8) is a chemical compound with the molecular formula C8H18Cl2N2 and a molecular weight of 213.15 g/mol. IUPAC name: (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine;dihydrochloride. InChIKey: KVYQKWPZQKGICY-KTNFEBOISA-N.
| Molecular formula | C8H18Cl2N2 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine;dihydrochloride |
| InChIKey | KVYQKWPZQKGICY-KTNFEBOISA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)N.Cl.Cl |
Computed by PubChem (NCBI)