Products 54240-91-4
CAS 54240-91-4 is the registry number for 3-Chloro-N,N-bis(cyanomethyl)benzamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-N,N-bis(cyanomethyl)benzamide (CAS 54240-91-4) is a chemical compound with the molecular formula C11H8ClN3O and a molecular weight of 233.65 g/mol. IUPAC name: 3-chloro-N,N-bis(cyanomethyl)benzamide. InChIKey: MCAVEAMXWWEXPR-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN3O |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 3-chloro-N,N-bis(cyanomethyl)benzamide |
| InChIKey | MCAVEAMXWWEXPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)N(CC#N)CC#N |
Computed by PubChem (NCBI)