CAS 62773-10-8 is the registry number for 11-(Chloromethyl)-1,8,10-triazatricyclo(7.4.0.0,2,7)trideca-2,4,6,9,11-pentaen-13-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(chloromethyl)-1H-pyrimido[1,2-a]benzimidazol-4-one (CAS 62773-10-8) is a chemical compound with the molecular formula C11H8ClN3O and a molecular weight of 233.65 g/mol. IUPAC name: 2-(chloromethyl)-1H-pyrimido[1,2-a]benzimidazol-4-one. InChIKey: VJPXGCKHJLCJKQ-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN3O |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 2-(chloromethyl)-1H-pyrimido[1,2-a]benzimidazol-4-one |
| InChIKey | VJPXGCKHJLCJKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3N2C(=O)C=C(N3)CCl |
Computed by PubChem (NCBI)