CAS 63860-33-3 is the registry number for 4-Chloro-2-(pyrimidine-4-carbonyl)aniline. Offered by: Biosynth. Available pack sizes: 1g, 0,1g.
(2-amino-5-chlorophenyl)-pyrimidin-4-ylmethanone (CAS 63860-33-3) is a chemical compound with the molecular formula C11H8ClN3O and a molecular weight of 233.65 g/mol. IUPAC name: (2-amino-5-chlorophenyl)-pyrimidin-4-ylmethanone. InChIKey: RFJLCOCEEPXUAL-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN3O |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | (2-amino-5-chlorophenyl)-pyrimidin-4-ylmethanone |
| InChIKey | RFJLCOCEEPXUAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)C2=NC=NC=C2)N |
Computed by PubChem (NCBI)