Products 5429-28-7
CAS 5429-28-7 appears in our catalog under these names: 4-Diethylaminobenzoic acid, 98%, 4-Diethylaminobenzoic Acid, 99%, 4–(Diethylamino)benzoic acid, 4-(N,N-Diethylamino)benzoic acid, 4-Diethylaminobenzoic Acid, >98.0%(GC)(T). Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 5g, 1g, 100g, 10g, 250g, 500g, 1000g.
4-(diethylamino)benzoic acid (CAS 5429-28-7) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 4-(diethylamino)benzoic acid. InChIKey: LNYTUARMNSFFBE-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 4-(diethylamino)benzoic acid |
| InChIKey | LNYTUARMNSFFBE-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)