CAS 5440-00-6 appears in our catalog under these names: Uracil Impurity 2, 5,6-Diamino-1,3-dimethyluracil, 5,6-Diamino-1,3-dimethyl uracil hydrate, 5,6-Diamino-1,3-dimethyl Uracil 98%, 5,6-DIAMINO-1,3-DIMETHYLURACIL HYDRATE,&. Offered by: Chemat Brand, Mikromol, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: on request, 25mg, 2g, 5g, 250mg, 1g, 25g, 500mg.
5,6-diamino-1,3-dimethylpyrimidine-2,4-dione (CAS 5440-00-6) is a chemical compound with the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. IUPAC name: 5,6-diamino-1,3-dimethylpyrimidine-2,4-dione. InChIKey: BGQNOPFTJROKJE-UHFFFAOYSA-N.
| Molecular formula | C6H10N4O2 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 5,6-diamino-1,3-dimethylpyrimidine-2,4-dione |
| InChIKey | BGQNOPFTJROKJE-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)N)N |
Computed by PubChem (NCBI)