CAS 54430-46-5 appears in our catalog under these names: Bz-Nle-OH, 97%, N–Benzoyl–L–norleucine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100g, 5g, 25g, 1g.
(2S)-2-benzamidohexanoic acid (CAS 54430-46-5) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: (2S)-2-benzamidohexanoic acid. InChIKey: NIOMUJJKCGJROX-NSHDSACASA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | (2S)-2-benzamidohexanoic acid |
| InChIKey | NIOMUJJKCGJROX-NSHDSACASA-N |
| SMILES | CCCC[C@@H](C(=O)O)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)