CAS 54441-66-6 is the registry number for tert-Butyl 3-oxo-3-phenylpropanoate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
Tert-butyl 3-oxo-3-phenylpropanoate (CAS 54441-66-6) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: tert-butyl 3-oxo-3-phenylpropanoate. InChIKey: PRTKMICNYGEWGB-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | tert-butyl 3-oxo-3-phenylpropanoate |
| InChIKey | PRTKMICNYGEWGB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)