CAS 5458-84-4 appears in our catalog under these names: 1-Iodo-2-methoxy-4-nitrobenzene 98%, 1-Iodo-2-methoxy-4-nitrobenzene, 97%, 1-Iodo-2-methoxy-4-nitrobenzene, 98%, 98%, 2–Iodo–5–Nitroanisole. Offered by: Ambeed, Fluorochem, Chemat, GLPBio. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
1-iodo-2-methoxy-4-nitrobenzene (CAS 5458-84-4) is a chemical compound with the molecular formula C7H6INO3 and a molecular weight of 279.03 g/mol. IUPAC name: 1-iodo-2-methoxy-4-nitrobenzene. InChIKey: RBFWMPRFYROKPI-UHFFFAOYSA-N.
| Molecular formula | C7H6INO3 |
|---|---|
| Molecular weight | 279.03 g/mol |
| IUPAC name | 1-iodo-2-methoxy-4-nitrobenzene |
| InChIKey | RBFWMPRFYROKPI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])I |
Computed by PubChem (NCBI)