Products 54611-10-8
CAS 54611-10-8 is the registry number for (5-chloro-2-methylphenyl)(phenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(5-chloro-2-methylphenyl)-phenylmethanol (CAS 54611-10-8) is a chemical compound with the molecular formula C14H13ClO and a molecular weight of 232.70 g/mol. IUPAC name: (5-chloro-2-methylphenyl)-phenylmethanol. InChIKey: LMQYKAPYAOUDKJ-UHFFFAOYSA-N.
| Molecular formula | C14H13ClO |
|---|---|
| Molecular weight | 232.70 g/mol |
| IUPAC name | (5-chloro-2-methylphenyl)-phenylmethanol |
| InChIKey | LMQYKAPYAOUDKJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)C(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)