Products 5465-18-9

CAS 5465-18-9 is the registry number for 4-(3,4-Dimethylphenyl)butanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(3,4-dimethylphenyl)butanoic acid (CAS 5465-18-9) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 4-(3,4-dimethylphenyl)butanoic acid. InChIKey: ABMVUAWFTZKZDV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O2
Molecular weight192.25 g/mol
IUPAC name4-(3,4-dimethylphenyl)butanoic acid
InChIKeyABMVUAWFTZKZDV-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)CCCC(=O)O)C

Computed by PubChem (NCBI)