CAS 54669-99-7 is the registry number for 5-Amino-3-bromo-2-hydroxybenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 10g.
5-amino-3-bromo-2-hydroxybenzoic acid (CAS 54669-99-7) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 5-amino-3-bromo-2-hydroxybenzoic acid. InChIKey: MKLFPGIAAXLPRB-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 5-amino-3-bromo-2-hydroxybenzoic acid |
| InChIKey | MKLFPGIAAXLPRB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)Br)N |
Computed by PubChem (NCBI)