CAS 5470-82-6 appears in our catalog under these names: 8-Amino-7-methylquinoline, 95%, 7-Methylquinolin-8-amine, 7-Methylquinolin-8-amine 98%, 7-Methylquinolin-8-amine, 96%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 0,5g, 5g, 100mg, 10g.
7-methylquinolin-8-amine (CAS 5470-82-6) is a chemical compound with the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. IUPAC name: 7-methylquinolin-8-amine. InChIKey: LOVKAXWPSDVFJO-UHFFFAOYSA-N.
| Molecular formula | C10H10N2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | 7-methylquinolin-8-amine |
| InChIKey | LOVKAXWPSDVFJO-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=CC=N2)C=C1)N |
Computed by PubChem (NCBI)