Products 54707-47-0
CAS 54707-47-0 appears in our catalog under these names: Selina-4(15),7(11)-dien-8-one, ≥90%, ≥90%, Selina-4(14),7(11)-dien-8-one. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, Get quote.
(4aS,8aR)-8a-methyl-5-methylidene-3-propan-2-ylidene-1,4,4a,6,7,8-hexahydronaphthalen-2-one (CAS 54707-47-0) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: (4aS,8aR)-8a-methyl-5-methylidene-3-propan-2-ylidene-1,4,4a,6,7,8-hexahydronaphthalen-2-one. InChIKey: NKGSEACIYQINQJ-DZGCQCFKSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | (4aS,8aR)-8a-methyl-5-methylidene-3-propan-2-ylidene-1,4,4a,6,7,8-hexahydronaphthalen-2-one |
| InChIKey | NKGSEACIYQINQJ-DZGCQCFKSA-N |
| SMILES | CC(=C1C[C@H]2C(=C)CCC[C@@]2(CC1=O)C)C |
Computed by PubChem (NCBI)