Products 54809-74-4
CAS 54809-74-4 appears in our catalog under these names: Oxysophoridine, (41S,7aR,13aR,13bR)-10-Oxododecahydro-1H,5H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridine 4(41H)-oxide, 98%, 98%, Oxysophoridine, 99.18%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 20mg, 1mg, 5mg, 100mg, 250mg, 1 mg, 5 mg.
(1R,2R,9R,17S)-13-oxido-7-aza-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one (CAS 54809-74-4) is a chemical compound with the molecular formula C15H24N2O2 and a molecular weight of 264.36 g/mol. IUPAC name: (1R,2R,9R,17S)-13-oxido-7-aza-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one. InChIKey: XVPBINOPNYFXID-ACTGZQEFSA-N.
| Molecular formula | C15H24N2O2 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | (1R,2R,9R,17S)-13-oxido-7-aza-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| InChIKey | XVPBINOPNYFXID-ACTGZQEFSA-N |
| SMILES | C1C[C@@H]2[C@H]3CCC[N+]4([C@H]3[C@H](CCC4)CN2C(=O)C1)[O-] |
Computed by PubChem (NCBI)