CAS 54828-63-6 appears in our catalog under these names: 6–Bromo–1–methoxynaphthalene, 6-Bromo-1-methoxynaphthalene, 95%, 6-Bromo-1-methoxynaphthalene, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg, 5g.
6-bromo-1-methoxynaphthalene (CAS 54828-63-6) is a chemical compound with the molecular formula C11H9BrO and a molecular weight of 237.09 g/mol. IUPAC name: 6-bromo-1-methoxynaphthalene. InChIKey: SKRSSNLRBLWLCE-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO |
|---|---|
| Molecular weight | 237.09 g/mol |
| IUPAC name | 6-bromo-1-methoxynaphthalene |
| InChIKey | SKRSSNLRBLWLCE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)