CAS 864866-46-6 is the registry number for 5'-Bromospiro[cyclopropane-1,2'-inden]-1'(3'H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromospiro[3H-indene-2,1'-cyclopropane]-1-one (CAS 864866-46-6) is a chemical compound with the molecular formula C11H9BrO and a molecular weight of 237.09 g/mol. IUPAC name: 5-bromospiro[3H-indene-2,1'-cyclopropane]-1-one. InChIKey: RDEYJXXOMRSNHF-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO |
|---|---|
| Molecular weight | 237.09 g/mol |
| IUPAC name | 5-bromospiro[3H-indene-2,1'-cyclopropane]-1-one |
| InChIKey | RDEYJXXOMRSNHF-UHFFFAOYSA-N |
| SMILES | C1CC12CC3=C(C2=O)C=CC(=C3)Br |
Computed by PubChem (NCBI)