CAS 62012-54-8 appears in our catalog under these names: 2-Bromo-1-methoxynaphthalene, 95%, 2-Bromo-1-methoxynaphthalene 95%, 2-bromo-1-methoxynaphthalene, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g, 100g, 50g, 10g.
2-bromo-1-methoxynaphthalene (CAS 62012-54-8) is a chemical compound with the molecular formula C11H9BrO and a molecular weight of 237.09 g/mol. IUPAC name: 2-bromo-1-methoxynaphthalene. InChIKey: UOVMWQHKZYGAGR-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO |
|---|---|
| Molecular weight | 237.09 g/mol |
| IUPAC name | 2-bromo-1-methoxynaphthalene |
| InChIKey | UOVMWQHKZYGAGR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC2=CC=CC=C21)Br |
Computed by PubChem (NCBI)