CAS 54864-83-4 appears in our catalog under these names: 6-Chloro-N,N-dimethylnicotinamide 97%, 6-CHLORO-N,N-DIMETHYLNICOTINAMIDE, 98%, 98%, 6-chloro-N,N-dimethylnicotinamide, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
6-chloro-N,N-dimethylpyridine-3-carboxamide (CAS 54864-83-4) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 6-chloro-N,N-dimethylpyridine-3-carboxamide. InChIKey: BPMBBXCPGAFTCX-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 6-chloro-N,N-dimethylpyridine-3-carboxamide |
| InChIKey | BPMBBXCPGAFTCX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CN=C(C=C1)Cl |
Computed by PubChem (NCBI)