Products 54877-97-3
CAS 54877-97-3 is the registry number for 10-Hydroxy-2,6,10-trimethyl-2,6,11-dodeca-4-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6E)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one (CAS 54877-97-3) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: (6E)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one. InChIKey: NYBCPVODSGRKRC-MDWZMJQESA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | (6E)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one |
| InChIKey | NYBCPVODSGRKRC-MDWZMJQESA-N |
| SMILES | CC(=CC(=O)C/C(=C/CCC(C)(C=C)O)/C)C |
Computed by PubChem (NCBI)