Products 58865-88-6
CAS 58865-88-6 is the registry number for 9-Oxonerolidol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
(6E,10S)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one (CAS 58865-88-6) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: (6E,10S)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one. InChIKey: NYBCPVODSGRKRC-XETPBLJFSA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | (6E,10S)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one |
| InChIKey | NYBCPVODSGRKRC-XETPBLJFSA-N |
| SMILES | CC(=CC(=O)C/C(=C/CC[C@@](C)(C=C)O)/C)C |
Computed by PubChem (NCBI)