Products 54911-88-5
CAS 54911-88-5 appears in our catalog under these names: Cis 5-hydroxy-cyclohex-3-enecarboxylic acid, 95%, Rel-(1R,5R)-5-hydroxycyclohex-3-ene-1-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(1R,5R)-5-hydroxycyclohex-3-ene-1-carboxylic acid (CAS 54911-88-5) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: (1R,5R)-5-hydroxycyclohex-3-ene-1-carboxylic acid. InChIKey: CNPPQIVHKLYCGG-RITPCOANSA-N.
| Molecular formula | C7H10O3 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | (1R,5R)-5-hydroxycyclohex-3-ene-1-carboxylic acid |
| InChIKey | CNPPQIVHKLYCGG-RITPCOANSA-N |
| SMILES | C1C=C[C@@H](C[C@@H]1C(=O)O)O |
Computed by PubChem (NCBI)