Products 54916-66-4
CAS 54916-66-4 appears in our catalog under these names: 5–Bromo–2–methoxypyridine–3–carboxylic acid, 5-Bromo-2-methoxynicotinic acid 97%, 5-Bromo-2-methoxynicotinic acid, 97%, 97%, 5-Bromo-2-methoxynicotinic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g, 1g.
5-bromo-2-methoxypyridine-3-carboxylic acid (CAS 54916-66-4) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 5-bromo-2-methoxypyridine-3-carboxylic acid. InChIKey: SJLXURQPRRMPIV-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 5-bromo-2-methoxypyridine-3-carboxylic acid |
| InChIKey | SJLXURQPRRMPIV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)Br)C(=O)O |
Computed by PubChem (NCBI)