CAS 54920-76-2 appears in our catalog under these names: 4–Hydroxy–1,7–naphthyridin–2(1H)–one, 1,7-Naphthyridine-2,4-diol, 95%, 1,7-Naphthyridine-2,4-diol. Offered by: GLPBio, Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 50mg.
4-hydroxy-1H-1,7-naphthyridin-2-one (CAS 54920-76-2) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 4-hydroxy-1H-1,7-naphthyridin-2-one. InChIKey: KIUIMHFSJVDAKN-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 4-hydroxy-1H-1,7-naphthyridin-2-one |
| InChIKey | KIUIMHFSJVDAKN-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=CC(=O)N2)O |
Computed by PubChem (NCBI)