Products 54965-57-0
CAS 54965-57-0 is the registry number for Theophylline Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-diethyl-7-methylpurine-2,6-dione (CAS 54965-57-0) is a chemical compound with the molecular formula C10H14N4O2 and a molecular weight of 222.24 g/mol. IUPAC name: 1,3-diethyl-7-methylpurine-2,6-dione. InChIKey: WGMHUEQTUNLCNK-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 1,3-diethyl-7-methylpurine-2,6-dione |
| InChIKey | WGMHUEQTUNLCNK-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C(=O)N(C1=O)CC)N(C=N2)C |
Computed by PubChem (NCBI)
Synonyms:
1,3-diethyl-7-methylxanthine, 1,3-Diethyl-7-methyl-3,7-dihydro-1H-purine-2,6-dione, Heteroxanthine, 1,3-diethyl-, Theophylline Impurity 24, Heteroxanthine,3-diethyl-, WGMHUEQTUNLCNK-UHFFFAOYSA-N, (1,3-diethyl-7methyl-3,7-dihydro-1Hpurine-2,6-dione), 1,3-Diethyl-7-methyl-3,7-dihydro-1H-purine-2,6-dione #