CAS 54981-34-9 appears in our catalog under these names: 1-(5-Bromo-2-hydroxyphenyl)-2-phenylethanone, 96%, 1-(5-Bromo-2-hydroxyphenyl)-2-phenylethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
1-(5-bromo-2-hydroxyphenyl)-2-phenylethanone (CAS 54981-34-9) is a chemical compound with the molecular formula C14H11BrO2 and a molecular weight of 291.14 g/mol. IUPAC name: 1-(5-bromo-2-hydroxyphenyl)-2-phenylethanone. InChIKey: GVURCXUQMQBAFD-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO2 |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | 1-(5-bromo-2-hydroxyphenyl)-2-phenylethanone |
| InChIKey | GVURCXUQMQBAFD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=C(C=CC(=C2)Br)O |
Computed by PubChem (NCBI)