CAS 54986-99-1 is the registry number for 2-(Thiophen-2-yl)-1,3-thiazole-5-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-thiophen-2-yl-1,3-thiazole-5-carbaldehyde (CAS 54986-99-1) is a chemical compound with the molecular formula C8H5NOS2 and a molecular weight of 195.3 g/mol. IUPAC name: 2-thiophen-2-yl-1,3-thiazole-5-carbaldehyde. InChIKey: OGLRIDOHTCKNEF-UHFFFAOYSA-N.
| Molecular formula | C8H5NOS2 |
|---|---|
| Molecular weight | 195.3 g/mol |
| IUPAC name | 2-thiophen-2-yl-1,3-thiazole-5-carbaldehyde |
| InChIKey | OGLRIDOHTCKNEF-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC=C(S2)C=O |
Computed by PubChem (NCBI)