Products 55-16-3
CAS 55-16-3 appears in our catalog under these names: HYOSCINE HYDROCHLORIDE, (-)-Scopolamine hydrochloride, Scopolamine (hydrochloride), 99.88%, (-)-Scopolamine hydrochloride analytical, (-)-Scopolamine hydrochloride, 98%. Offered by: GLPBio, Biosynth, MedChemExpress, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg, 100 mg, 25 mg, 10 mg.
[(1R,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate;hydrochloride (CAS 55-16-3) is a chemical compound with the molecular formula C17H22ClNO4 and a molecular weight of 339.8 g/mol. IUPAC name: [(1R,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate;hydrochloride. InChIKey: KXPXJGYSEPEXMF-WYHSTMEOSA-N.
| Molecular formula | C17H22ClNO4 |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | [(1R,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate;hydrochloride |
| InChIKey | KXPXJGYSEPEXMF-WYHSTMEOSA-N |
| SMILES | CN1[C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)OC(=O)[C@H](CO)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)