CAS 550-37-8 appears in our catalog under these names: Butylphthalide Impurity 7, 2-PENTANOYLBENZOIC ACID, Butylphthalide Impurity 24, Benzoic acid,2-(1-oxopentyl)-, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5g.
2-pentanoylbenzoic acid (CAS 550-37-8) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 2-pentanoylbenzoic acid. InChIKey: SWAMOIJQDQZLRX-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2-pentanoylbenzoic acid |
| InChIKey | SWAMOIJQDQZLRX-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)C1=CC=CC=C1C(=O)O |
Computed by PubChem (NCBI)