CAS 55034-26-9 appears in our catalog under these names: methyl 4-aminobenzenesulfonate, Sulfanilic Acid Methyl Ester. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-aminobenzenesulfonate (CAS 55034-26-9) is a chemical compound with the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. IUPAC name: methyl 4-aminobenzenesulfonate. InChIKey: QIJOHVUUUWKJBT-UHFFFAOYSA-N.
| Molecular formula | C7H9NO3S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | methyl 4-aminobenzenesulfonate |
| InChIKey | QIJOHVUUUWKJBT-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)