CAS 55104-32-0 is the registry number for 6-hydroxy-1,3-dihydro-2-benzofuran-1-one. Offered by: TRC, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-hydroxy-3H-2-benzofuran-1-one (CAS 55104-32-0) is a chemical compound with the molecular formula C8H6O3 and a molecular weight of 150.13 g/mol. IUPAC name: 6-hydroxy-3H-2-benzofuran-1-one. InChIKey: HWIZGBVJDMPJRO-UHFFFAOYSA-N.
| Molecular formula | C8H6O3 |
|---|---|
| Molecular weight | 150.13 g/mol |
| IUPAC name | 6-hydroxy-3H-2-benzofuran-1-one |
| InChIKey | HWIZGBVJDMPJRO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)O)C(=O)O1 |
Computed by PubChem (NCBI)