Products 55136-48-6
CAS 55136-48-6 appears in our catalog under these names: (S)–3–Carboxy–4–hydroxyphenylglycine, (S)-3C4HPG. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, Get quote.
5-[(S)-amino(carboxy)methyl]-2-hydroxybenzoic acid (CAS 55136-48-6) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 5-[(S)-amino(carboxy)methyl]-2-hydroxybenzoic acid. InChIKey: CHZBCZTXSTWCIG-ZETCQYMHSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 5-[(S)-amino(carboxy)methyl]-2-hydroxybenzoic acid |
| InChIKey | CHZBCZTXSTWCIG-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C=C1[C@@H](C(=O)O)N)C(=O)O)O |
Computed by PubChem (NCBI)