Products 55169-98-7
CAS 55169-98-7 is the registry number for 3,5-Dimethyl-2-methoxyacetophenone. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
1-(2-methoxy-3,5-dimethylphenyl)ethanone (CAS 55169-98-7) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 1-(2-methoxy-3,5-dimethylphenyl)ethanone. InChIKey: DWERFCCYBUXHNJ-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 1-(2-methoxy-3,5-dimethylphenyl)ethanone |
| InChIKey | DWERFCCYBUXHNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(=O)C)OC)C |
Computed by PubChem (NCBI)