CAS 552-32-9 appears in our catalog under these names: 2'-Nitroacetanilide, 95%, 2'–Nitroacetanilide, 2'-Nitroacetanilide, 98+% , 2'-Nitroacetanilide, >98.0%(GC), 2-Nitroacetanilide. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 1g, 5g, 25g, 100g, 50g, 250g, 10g.
N-(2-nitrophenyl)acetamide (CAS 552-32-9) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: N-(2-nitrophenyl)acetamide. InChIKey: BUNFNRVLMKHKIT-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | N-(2-nitrophenyl)acetamide |
| InChIKey | BUNFNRVLMKHKIT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)