Products 55218-08-1
CAS 55218-08-1 appears in our catalog under these names: 2,6-Dimethoxy-1-naphthaldehyde, 97%, 2,6-Dimethoxy-1-naphthaldehyde, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-dimethoxynaphthalene-1-carbaldehyde (CAS 55218-08-1) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: 2,6-dimethoxynaphthalene-1-carbaldehyde. InChIKey: SZKBFOWEOKWEDD-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 2,6-dimethoxynaphthalene-1-carbaldehyde |
| InChIKey | SZKBFOWEOKWEDD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=C(C=C2)OC)C=O |
Computed by PubChem (NCBI)