CAS 55304-10-4 is the registry number for 3-(3-Isopropylphenyl)-1,1-dimethylurea. Offered by: Mikromol. Available pack sizes: 25mg.
1,1-dimethyl-3-(3-propan-2-ylphenyl)urea (CAS 55304-10-4) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: 1,1-dimethyl-3-(3-propan-2-ylphenyl)urea. InChIKey: QWZWEJVCSVTACA-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 1,1-dimethyl-3-(3-propan-2-ylphenyl)urea |
| InChIKey | QWZWEJVCSVTACA-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC=C1)NC(=O)N(C)C |
Computed by PubChem (NCBI)