CAS 55307-37-4 is the registry number for 1,3-dimethyl-2,4-dioxo-2,3,4,7-tetrahydro-1h-pyrrolo(2,3-d)pyrimidine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 10mg, 5mg.
1,3-dimethyl-2,4-dioxo-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid (CAS 55307-37-4) is a chemical compound with the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. IUPAC name: 1,3-dimethyl-2,4-dioxo-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid. InChIKey: DXQAFUQFCYEXLL-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O4 |
|---|---|
| Molecular weight | 223.19 g/mol |
| IUPAC name | 1,3-dimethyl-2,4-dioxo-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | DXQAFUQFCYEXLL-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(N2)C(=O)O)C(=O)N(C1=O)C |
Computed by PubChem (NCBI)