CAS 554-99-4 is the registry number for Noradrenaline (Norepinephrine) Impurity 32. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-(dimethylamino)-1-hydroxyethyl]benzene-1,2-diol (CAS 554-99-4) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: 4-[2-(dimethylamino)-1-hydroxyethyl]benzene-1,2-diol. InChIKey: RLATYNCITHOLTJ-UHFFFAOYSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 4-[2-(dimethylamino)-1-hydroxyethyl]benzene-1,2-diol |
| InChIKey | RLATYNCITHOLTJ-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C1=CC(=C(C=C1)O)O)O |
Computed by PubChem (NCBI)