CAS 5541-68-4 appears in our catalog under these names: 7-Methylquinolin-8-ol, 95%, 7-Methylquinolin-8-ol, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg.
7-methylquinolin-8-ol (CAS 5541-68-4) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 7-methylquinolin-8-ol. InChIKey: LUOZEWPJSYBORW-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 7-methylquinolin-8-ol |
| InChIKey | LUOZEWPJSYBORW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=CC=N2)C=C1)O |
Computed by PubChem (NCBI)