Products 55417-64-6
CAS 55417-64-6 is the registry number for Ethyl 3-(4-bromophenyl)-2-cyanobut-2-enoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Ethyl (E)-3-(4-bromophenyl)-2-cyanobut-2-enoate (CAS 55417-64-6) is a chemical compound with the molecular formula C13H12BrNO2 and a molecular weight of 294.14 g/mol. IUPAC name: ethyl (E)-3-(4-bromophenyl)-2-cyanobut-2-enoate. InChIKey: ASDNBQXYDPUCHU-FMIVXFBMSA-N.
| Molecular formula | C13H12BrNO2 |
|---|---|
| Molecular weight | 294.14 g/mol |
| IUPAC name | ethyl (E)-3-(4-bromophenyl)-2-cyanobut-2-enoate |
| InChIKey | ASDNBQXYDPUCHU-FMIVXFBMSA-N |
| SMILES | CCOC(=O)/C(=C(\C)/C1=CC=C(C=C1)Br)/C#N |
Computed by PubChem (NCBI)