CAS 554405-54-8 is the registry number for 2-Chloro-N-(2-methyl-3-nitrophenyl)acetamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-chloro-N-(2-methyl-3-nitrophenyl)acetamide (CAS 554405-54-8) is a chemical compound with the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. IUPAC name: 2-chloro-N-(2-methyl-3-nitrophenyl)acetamide. InChIKey: LFYAHDMPGMNGIW-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O3 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 2-chloro-N-(2-methyl-3-nitrophenyl)acetamide |
| InChIKey | LFYAHDMPGMNGIW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1[N+](=O)[O-])NC(=O)CCl |
Computed by PubChem (NCBI)