CAS 554423-96-0 appears in our catalog under these names: 5-(5-Chloro-2-methoxy-phenyl)-4h-[1,2,4]triazole-3-thiol, 95%, 5-(5-Chloro-2-methoxyphenyl)-4H-1,2,4-triazole-3-thiol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-(5-chloro-2-methoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 554423-96-0) is a chemical compound with the molecular formula C9H8ClN3OS and a molecular weight of 241.70 g/mol. IUPAC name: 5-(5-chloro-2-methoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: RJPQQJHHHGTVRK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3OS |
|---|---|
| Molecular weight | 241.70 g/mol |
| IUPAC name | 5-(5-chloro-2-methoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | RJPQQJHHHGTVRK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)C2=NC(=S)NN2 |
Computed by PubChem (NCBI)